
5832-44-0
| Name | 4-Methyl-3-nitropyridine |
| CAS | 5832-44-0 |
| EINECS(EC#) | 628-685-7 |
| Molecular Formula | C6H6N2O2 |
| MDL Number | MFCD00051829 |
| Molecular Weight | 138.12 |
| MOL File | 5832-44-0.mol |
Chemical Properties
| Appearance | Deliquescent cryst |
| Melting point | 24-28 °C |
| Boiling point | 238 °C |
| density | 1.228 g/mL at 25 °C |
| refractive index | n |
| Fp | 227 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to lump to clear liquid |
| pka | 1.87±0.18(Predicted) |
| color | White or Colorless to Yellow |
| BRN | 118796 |
| InChI | InChI=1S/C6H6N2O2/c1-5-2-3-7-4-6(5)8(9)10/h2-4H,1H3 |
| InChIKey | JLNRJMGYBKMDGI-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(C)=C1[N+]([O-])=O |
| CAS DataBase Reference | 5832-44-0(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,T,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |