4487-59-6
| Name | 2-Bromo-5-nitropyridine |
| CAS | 4487-59-6 |
| EINECS(EC#) | 224-777-2 |
| Molecular Formula | C5H3BrN2O2 |
| MDL Number | MFCD00006222 |
| Molecular Weight | 202.99 |
| MOL File | 4487-59-6.mol |
Chemical Properties
| Appearance | Off-white to light yellow crystal. |
| Melting point | 139-141 °C (lit.) |
| Boiling point | 145-147 °C/10 mmHg (lit.) |
| density | 1.8727 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| Fp | 145-147°C/10mm |
| storage temp. | Keep Cold |
| solubility | Chloroform, Hot Methanol |
| form | Crystalline Powder |
| pka | -3.24±0.10(Predicted) |
| color | Light yellow to light brown |
| Water Solubility | Insoluble in water. |
| Detection Methods | HPLC |
| BRN | 120901 |
| InChI | InChI=1S/C5H3BrN2O2/c6-5-2-1-4(3-7-5)8(9)10/h1-3H |
| InChIKey | HUUFTVUBFFESEN-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 4487-59-6(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |