5315-25-3
| Name | 2-Bromo-6-methylpyridine |
| CAS | 5315-25-3 |
| EINECS(EC#) | 226-173-4 |
| Molecular Formula | C6H6BrN |
| MDL Number | MFCD00040743 |
| Molecular Weight | 172.02 |
| MOL File | 5315-25-3.mol |
Chemical Properties
| Appearance | Light yellow liquid |
| Boiling point | 102-103 °C/20 mmHg (lit.) |
| density | 1.512 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 207 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Ethyl Aceate |
| form | Liquid |
| pka | 1.51±0.10(Predicted) |
| color | Clear colorless to yellow |
| Specific Gravity | 1.512 |
| Water Solubility | Soluble in chloroform, ethyl aceate. Not miscible or difficult to mix with water. |
| Detection Methods | GC,NMR |
| BRN | 107322 |
| InChI | InChI=1S/C6H6BrN/c1-5-3-2-4-6(7)8-5/h2-4H,1H3 |
| InChIKey | SOHDPICLICFSOP-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC(C)=CC=C1 |
| CAS DataBase Reference | 5315-25-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |