1668-54-8
| Name | 2-Amino-4-methoxy-6-methyl-1,3,5-triazine |
| CAS | 1668-54-8 |
| EINECS(EC#) | 216-790-7 |
| Molecular Formula | C5H8N4O |
| MDL Number | MFCD00052764 |
| Molecular Weight | 140.14 |
| MOL File | 1668-54-8.mol |
Chemical Properties
| Appearance | off-white to light yellow powder |
| Melting point | 258-261 °C(lit.) |
| Boiling point | 114℃ |
| density | 1.2945 (rough estimate) |
| refractive index | 1.8300 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 3.65±0.10(Predicted) |
| color | White to Light Yellow |
| InChI | InChI=1S/C5H8N4O/c1-3-7-4(6)9-5(8-3)10-2/h1-2H3,(H2,6,7,8,9) |
| InChIKey | NXFQWRWXEYTOTK-UHFFFAOYSA-N |
| SMILES | N1=C(C)N=C(OC)N=C1N |
| CAS DataBase Reference | 1668-54-8(CAS DataBase Reference) |
| EPA Substance Registry System | 1668-54-8(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| RTECS | XY3193000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29336990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
