3430-14-6
| Name | 5-Amino-2-methylpyridine |
| CAS | 3430-14-6 |
| EINECS(EC#) | 625-232-5 |
| Molecular Formula | C6H8N2 |
| MDL Number | MFCD00833389 |
| Molecular Weight | 108.14 |
| MOL File | 3430-14-6.mol |
Chemical Properties
| Melting point | 95-99°C |
| Boiling point | 238.4±20.0 °C(Predicted) |
| density | 1.068±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 6.89±0.10(Predicted) |
| color | Off-white to orange to brown |
| Detection Methods | HPLC |
| InChI | InChI=1S/C6H8N2/c1-5-2-3-6(7)4-8-5/h2-4H,7H2,1H3 |
| InChIKey | UENBBJXGCWILBM-UHFFFAOYSA-N |
| SMILES | C1=NC(C)=CC=C1N |
| LogP | 0.704 |
| CAS DataBase Reference | 3430-14-6(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
