15513-52-7
| Name | 2,6-Dimethyl-3-nitropyridine |
| CAS | 15513-52-7 |
| EINECS(EC#) | 239-543-5 |
| Molecular Formula | C7H8N2O2 |
| MDL Number | MFCD00023503 |
| Molecular Weight | 152.15 |
| MOL File | 15513-52-7.mol |
Chemical Properties
| Appearance | Off-white to tan powder |
| Melting point | 26-31 °C (lit.) |
| Boiling point | 105°C/10mmHg(lit.) |
| density | 1.45 |
| Fp | 100 °F |
| storage temp. | Flammables area |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 2?+-.0.10(Predicted) |
| color | Off-white to tan |
| InChI | 1S/C7H8N2O2/c1-5-3-4-7(9(10)11)6(2)8-5/h3-4H,1-2H3 |
| InChIKey | AETHUDGJSSKZKT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(c(C)n1)[N+]([O-])=O |
| CAS DataBase Reference | 15513-52-7(CAS DataBase Reference) |
Safety Data
| Hazard Codes | F,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1325 4.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29333999 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |