14264-16-5
| Name | Bis(triphenylphosphine)nickel(II)chloride |
| CAS | 14264-16-5 |
| EINECS(EC#) | 238-154-8 |
| Molecular Formula | C36H30Cl2NiP2 |
| MDL Number | MFCD00009592 |
| Molecular Weight | 654.17 |
| MOL File | 14264-16-5.mol |
Chemical Properties
| Appearance | dark green to dark grey crystals or powder |
| Melting point | 250 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystals or Powder |
| color | Dark green to dark gray |
| Water Solubility | insoluble |
| Sensitive | Hygroscopic |
| Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 |
| InChI | InChI=1S/2C18H15P.2ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+2/p-2 |
| InChIKey | ZBRJXVVKPBZPAN-UHFFFAOYSA-L |
| SMILES | P(C1C=CC=CC=1)(C1=CC=CC=C1)C1C=CC=CC=1.P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.[Ni](Cl)Cl |
| CAS DataBase Reference | 14264-16-5(CAS DataBase Reference) |
| NIST Chemistry Reference | dichlorobis(triphenylphosphine)nickel(14264-16-5) |
| Storage Precautions | Store under nitrogen |
| EPA Substance Registry System | Nickel, dichlorobis(triphenylphosphine)- (14264-16-5) |
Safety Data
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H350-H412 |
| Precautionary statements | P201-P273-P280-P302+P352-P308+P313 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3260 |
| WGK Germany | 3 |
| RTECS | QR6170000 |
| F | 21 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29310095 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Aquatic Chronic 3 Carc. 1B Skin Sens. 1 |
;