
13061-96-6
| Name | Methylboronic acid |
| CAS | 13061-96-6 |
| EINECS(EC#) | 629-203-8 |
| Molecular Formula | CH5BO2 |
| MDL Number | MFCD00002105 |
| Molecular Weight | 59.86 |
| MOL File | 13061-96-6.mol |
Chemical Properties
| Appearance | White to light yellow crystal powde |
| Melting point | 91-94 °C (lit.) |
| Boiling point | 141.7±23.0 °C(Predicted) |
| density | 0.965±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO, Water |
| form | Crystalline Powder |
| pka | 9.97±0.43(Predicted) |
| color | White to off-white |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| Detection Methods | NMR |
| BRN | 1731087 |
| InChI | InChI=1S/CH5BO2/c1-2(3)4/h3-4H,1H3 |
| InChIKey | KTMKRRPZPWUYKK-UHFFFAOYSA-N |
| SMILES | CB(O)O |
| CAS DataBase Reference | 13061-96-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29319099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

