5467-74-3
| Name | 4-Bromophenylboronic acid |
| CAS | 5467-74-3 |
| EINECS(EC#) | 226-779-9 |
| Molecular Formula | C6H6BBrO2 |
| MDL Number | MFCD00002104 |
| Molecular Weight | 200.83 |
| MOL File | 5467-74-3.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 284-288 °C (lit.) |
| Boiling point | 315.0±44.0 °C(Predicted) |
| density | 1.67±0.1 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| form | Crystalline Powder |
| pka | 8.32±0.10(Predicted) |
| color | Off-white to light beige |
| Water Solubility | Soluble in methanol. Insoluble in water. |
| BRN | 2936347 |
| InChI | InChI=1S/C6H6BBrO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4,9-10H |
| InChIKey | QBLFZIBJXUQVRF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(Br)C=C1)(O)O |
| CAS DataBase Reference | 5467-74-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | CY8650000 |
| Hazard Note | Irritant |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29319099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
