244205-40-1
| Name | 2-Bromophenylboronic acid |
| CAS | 244205-40-1 |
| EINECS(EC#) | 678-199-4 |
| Molecular Formula | C6H6BBrO2 |
| MDL Number | MFCD01114672 |
| Molecular Weight | 200.83 |
| MOL File | 244205-40-1.mol |
Chemical Properties
| Appearance | White to off-white powder |
| Melting point | 113 °C(lit.) |
| Boiling point | 329.2±44.0 °C(Predicted) |
| density | 1.67±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator (+4°C) |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly), Methanol (Sparingly) |
| form | Powder |
| pka | 8.25±0.58(Predicted) |
| color | White to off-white |
| Water Solubility | Soluble in methanol. Slightly soluble in water. |
| BRN | 8542615 |
| InChI | InChI=1S/C6H6BBrO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4,9-10H |
| InChIKey | PLVCYMZAEQRYHJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1Br)(O)O |
| CAS DataBase Reference | 244205-40-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |