2042-37-7
| Name | 2-Bromobenzonitrile |
| CAS | 2042-37-7 |
| EINECS(EC#) | 218-045-1 |
| Molecular Formula | C7H4BrN |
| MDL Number | MFCD00001772 |
| Molecular Weight | 182.02 |
| MOL File | 2042-37-7.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 53-57 °C(lit.) |
| Boiling point | 251-253 °C(lit.) |
| density | 1.496 |
| refractive index | 1.5999 (estimate) |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 10.5g/l |
| form | Crystalline Solid |
| color | White to yellow |
| PH | 6.6 (10.5g/l, H2O, 23℃) |
| BRN | 2042185 |
| InChI | InChI=1S/C7H4BrN/c8-7-4-2-1-3-6(7)5-9/h1-4H |
| InChIKey | AFMPMSCZPVNPEM-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC=C1Br |
| CAS DataBase Reference | 2042-37-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzonitrile, 2-bromo-(2042-37-7) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312-H319-H412 |
| Precautionary statements | P264-P273-P280-P301+P310-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 2 |
| RTECS | DI2459750 |
| Hazard Note | Harmful/Irritant |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Chronic 3 Eye Irrit. 2 |