
10365-98-7
| Name | 3-Methoxyphenylboronic acid |
| CAS | 10365-98-7 |
| EINECS(EC#) | 600-467-6 |
| Molecular Formula | C7H9BO3 |
| MDL Number | MFCD00161359 |
| Molecular Weight | 151.96 |
| MOL File | 10365-98-7.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 160-163 °C (lit.) |
| Boiling point | 318.6±44.0 °C(Predicted) |
| density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 8.10±0.10(Predicted) |
| color | White to light beige |
| Detection Methods | HPLC,NMR |
| BRN | 2831223 |
| InChI | InChI=1S/C7H9BO3/c1-11-7-4-2-3-6(5-7)8(9)10/h2-5,9-10H,1H3 |
| InChIKey | NLLGFYPSWCMUIV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(OC)=C1)(O)O |
| CAS DataBase Reference | 10365-98-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29319099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
