5720-07-0
| Name | 4-Methoxyphenylboronic acid |
| CAS | 5720-07-0 |
| EINECS(EC#) | 216-845-5 |
| Molecular Formula | C7H9BO3 |
| MDL Number | MFCD00039139 |
| Molecular Weight | 151.96 |
| MOL File | 5720-07-0.mol |
Chemical Properties
| Appearance | white to light beige crystalline powder |
| Melting point | 204-206 °C(lit.) |
| Boiling point | 306.8±44.0 °C(Predicted) |
| density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator (+4°C) |
| solubility | Soluble in dimethyl sulfoxide and methanol. |
| form | Crystalline Powder |
| pka | 8.96±0.10(Predicted) |
| color | White to light beige |
| Detection Methods | HPLC |
| BRN | 2936912 |
| InChI | InChI=1S/C7H9BO3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5,9-10H,1H3 |
| InChIKey | VOAAEKKFGLPLLU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(OC)C=C1)(O)O |
| CAS DataBase Reference | 5720-07-0(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | CY8975000 |
| Hazard Note | Irritant |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |