
5470-22-4
| Name | 4-Chloropyridine-2-carboxylic acid |
| CAS | 5470-22-4 |
| EINECS(EC#) | 676-597-2 |
| Molecular Formula | C6H4ClNO2 |
| MDL Number | MFCD00191400 |
| Molecular Weight | 157.55 |
| MOL File | 5470-22-4.mol |
Chemical Properties
| Melting point | 181°C |
| Boiling point | 308.0±22.0 °C(Predicted) |
| density | 1.470±0.06 g/cm3(Predicted) |
| storage temp. | Keep Cold |
| form | powder to crystal |
| pka | 3.27±0.10(Predicted) |
| color | White to Almost white |
| Detection Methods | HPLC |
| InChI | InChI=1S/C6H4ClNO2/c7-4-1-2-8-5(3-4)6(9)10/h1-3H,(H,9,10) |
| InChIKey | NNMYRMGMVLMQAY-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=CC(Cl)=C1 |
| CAS DataBase Reference | 5470-22-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
