
1765-93-1
| Name | 4-Fluorobenzeneboronic acid |
| CAS | 1765-93-1 |
| EINECS(EC#) | 605-778-0 |
| Molecular Formula | C6H6BFO2 |
| MDL Number | MFCD00039136 |
| Molecular Weight | 139.92 |
| MOL File | 1765-93-1.mol |
Chemical Properties
| Appearance | yellow to beige crystalline or fluffy powder |
| Melting point | 262-265 °C (lit.) |
| Boiling point | 258.4±42.0 °C(Predicted) |
| density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| Water Solubility | Slightly soluble in water |
| form | Crystalline or Fluffy Powder |
| pka | 8.67±0.10(Predicted) |
| color | Yellow to beige |
| Usage | Intermediates of Liquid Crystals |
| BRN | 2829653 |
| InChI | InChI=1S/C6H6BFO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4,9-10H |
| InChIKey | LBUNNMJLXWQQBY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(F)C=C1)(O)O |
| CAS DataBase Reference | 1765-93-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Fluorobenzeneboronic acid(1765-93-1) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29319099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
