768-35-4
| Name | 3-Fluorophenylboronic acid |
| CAS | 768-35-4 |
| EINECS(EC#) | 476-720-8 |
| Molecular Formula | C6H6BFO2 |
| MDL Number | MFCD00236042 |
| Molecular Weight | 139.92 |
| MOL File | 768-35-4.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 214-218 °C (lit.) |
| Boiling point | 271.4±42.0 °C(Predicted) |
| density | 1.24±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | 0-6°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 7.50±0.10(Predicted) |
| color | White to off-white |
| Water Solubility | 27.1g/L at 20℃ |
| Usage | Intermediates of Liquid Crystals |
| Detection Methods | HPLC,NMR |
| BRN | 3030632 |
| InChI | InChI=1S/C6H6BFO2/c8-6-3-1-2-5(4-6)7(9)10/h1-4,9-10H |
| InChIKey | KNXQDJCZSVHEIW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(F)=C1)(O)O |
| LogP | 2 at 23℃ |
| CAS DataBase Reference | 768-35-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | No |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29319099 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |