
102-28-3
| Name | N1-(3-Aminophenyl)acetamide |
| CAS | 102-28-3 |
| EINECS(EC#) | 203-021-5 |
| Molecular Formula | C8H10N2O |
| MDL Number | MFCD00025229 |
| Molecular Weight | 150.18 |
| MOL File | 102-28-3.mol |
Chemical Properties
| Appearance | light brown crystalline powder |
| Melting point | 86-88 °C(lit.) |
| Boiling point | 271.72°C (rough estimate) |
| density | 1.1392 (rough estimate) |
| refractive index | 1.6180 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 14.82±0.70(Predicted) |
| color | White to Gray to Brown |
| Water Solubility | 1-5 g/100 mL at 24 ºC |
| InChI | InChI=1S/C8H10N2O/c1-6(11)10-8-4-2-3-7(9)5-8/h2-5H,9H2,1H3,(H,10,11) |
| InChIKey | PEMGGJDINLGTON-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=CC(N)=C1)(=O)C |
| CAS DataBase Reference | 102-28-3(CAS DataBase Reference) |
| EPA Substance Registry System | 102-28-3(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | AD8050000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
