3006-93-7
| Name | N,N'-1,3-Phenylene bismaleimide |
| CAS | 3006-93-7 |
| EINECS(EC#) | 221-112-8 |
| Molecular Formula | C14H8N2O4 |
| MDL Number | MFCD00022569 |
| Molecular Weight | 268.22 |
| MOL File | 3006-93-7.mol |
Chemical Properties
| Appearance | yellow crystalline powder |
| Melting point | 198-201 °C(lit.) |
| Boiling point | 411.39°C (rough estimate) |
| density | 1.3140 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5910 (estimate) |
| Fp | >208℃ |
| storage temp. | Poison room |
| form | powder to crystal |
| pka | -1.67±0.20(Predicted) |
| color | Light yellow to Brown to Dark green |
| Water Solubility | negligible soluble |
| InChI | InChI=1S/C14H8N2O4/c17-11-4-5-12(18)15(11)9-2-1-3-10(8-9)16-13(19)6-7-14(16)20/h1-8H |
| InChIKey | IPJGAEWUPXWFPL-UHFFFAOYSA-N |
| SMILES | C1(N2C(=O)C=CC2=O)=CC=CC(N2C(=O)C=CC2=O)=C1 |
| LogP | 0.67 at 24℃ |
| CAS DataBase Reference | 3006-93-7(CAS DataBase Reference) |
| EPA Substance Registry System | 3006-93-7(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H330 |
| Precautionary statements | P301+P312+P330-P304+P340+P310 |
| Hazard Codes | T,Xi,T+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | ON6125000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 38220090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral |
| Toxicity |