122-28-1
| Name | 3'-NITROACETANILIDE |
| CAS | 122-28-1 |
| EINECS(EC#) | 204-532-6 |
| Molecular Formula | C8H8N2O3 |
| MDL Number | MFCD00017015 |
| Molecular Weight | 180.16 |
| MOL File | 122-28-1.mol |
Chemical Properties
| Appearance | Beige crystalline to brown powder |
| Melting point | 154-158 °C(lit.) |
| Boiling point | 312.97°C (rough estimate) |
| density | 1.340 |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | almost transparency in hot Methanol |
| form | powder to crystal |
| pka | 14.20±0.70(Predicted) |
| color | White to Light yellow to Green |
| Merck | 14,6581 |
| BRN | 2211961 |
| InChI | 1S/C8H8N2O3/c1-6(11)9-7-3-2-4-8(5-7)10(12)13/h2-5H,1H3,(H,9,11) |
| InChIKey | KFTYNYHJHKCRKU-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(c1)[N+]([O-])=O |
| CAS DataBase Reference | 122-28-1(CAS DataBase Reference) |
| EPA Substance Registry System | Acetamide, N-(3-nitrophenyl)- (122-28-1) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |