| Melting point |
35-37 °C(lit.) |
| Boiling point |
95-97 °C1 mm Hg(lit.) |
| Density |
1.151 |
| refractive index |
1.5325-1.5345 |
| Flash point |
>230 °F |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
Insoluble |
| BRN |
1100638 |
| InChI |
InChI=1S/C9H9ClO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChIKey |
ADCYRBXQAJXJTD-UHFFFAOYSA-N |
| SMILES |
C(C1=CC=C(Cl)C=C1)(=O)CC |
| LogP |
2.4 |
| CAS DataBase Reference |
6285-05-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
1-Propanone, 1-(4-chlorophenyl)-(6285-05-8) |
| EPA Substance Registry System |
1-Propanone, 1-(4-chlorophenyl)- (6285-05-8) |
