4'-Bromopropiophenone
- Product Name4'-Bromopropiophenone
- CAS10342-83-3
- MFC9H9BrO
- MW213.07
- EINECS233-745-7
- MOL File10342-83-3.mol
Chemical Properties
| Melting point | 45-47 °C(lit.) |
| Boiling point | 138-140 °C14 mm Hg(lit.) |
| Density | 1.3841 (rough estimate) |
| refractive index | 1.5720 (estimate) |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 1210311 |
| InChI | InChI=1S/C9H9BrO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | UOMOSYFPKGQIKI-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Br)C=C1)(=O)CC |
| CAS DataBase Reference | 10342-83-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Propanone, 1-(4-bromophenyl)-(10342-83-3) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |