Tetrachlorobis(tetrahydrofuran)titanium(IV)
- Product NameTetrachlorobis(tetrahydrofuran)titanium(IV)
- CAS31011-57-1
- MFC8H16Cl4O2Ti
- MW333.89
- EINECS
- MOL File31011-57-1.mol
Chemical Properties
| Melting point | 126-128 °C(lit.) |
| Flash point | 1 °F |
| storage temp. | 2-8°C |
| form | crystal |
| color | yellow |
| Water Solubility | Reacts with water |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/2C4H8O.4ClH.Ti/c2*1-2-4-5-3-1;;;;;/h2*1-4H2;4*1H;/q;;;;;;+4/p-4 |
| InChIKey | LXWBMENBONGPSB-UHFFFAOYSA-J |
| SMILES | [Ti](Cl)(Cl)(Cl)Cl.C1COCC1.C1COCC1 |
| CAS DataBase Reference | 31011-57-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 14-34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2925 4.1/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Flam. Sol. 1 Skin Corr. 1B |