2,5-Di(tert-butylperoxy)-2,5-dimethyl-3-hexyne
- Product Name2,5-Di(tert-butylperoxy)-2,5-dimethyl-3-hexyne
- CAS1068-27-5
- MFC16H30O4
- MW286.41
- EINECS213-944-5
- MOL File1068-27-5.mol
Chemical Properties
| Melting point | 88 °C (SADT)(lit.) |
| Boiling point | 348.77°C (rough estimate) |
| Density | 1.26 g/mL at 25 °C(lit.) |
| vapor pressure | 0.011Pa at 20℃ |
| refractive index | 1.4340 (estimate) |
| Flash point | 188 °F |
| storage temp. | 2-8°C |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 2.2mg/L at 20℃ |
| InChI | 1S/C16H30O4/c1-13(2,3)17-19-15(7,8)11-12-16(9,10)20-18-14(4,5)6/h1-10H3 |
| InChIKey | ODBCKCWTWALFKM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OOC(C)(C)C#CC(C)(C)OOC(C)(C)C |
| LogP | 6.71 at 25℃ |
| CAS DataBase Reference | 1068-27-5(CAS DataBase Reference) |
| EPA Substance Registry System | Peroxide, 1,1'-(1,1,4,4-tetramethyl-2-butyne-1,4-diyl)bis[2-(1,1-dimethylethyl) (1068-27-5) |
Safety Information
| Hazard Codes | O,Xi,Xn,F,E |
| Risk Statements | 8-38-36/37/38-7-41-37/38-20-11-36/38-2 |
| Safety Statements | 7-17-36/37/39-36-26-3/7-14-47-35 |
| RIDADR | UN 3106 5.2 |
| WGK Germany | 3 |
| RTECS | MQ9750000 |
| TSCA | TSCA listed |
| HazardClass | 5.2 |
| PackingGroup | II |
| HS Code | 29096000 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Org. Perox. D Skin Irrit. 2 |