(+)-3-Methylcyclohexanone
- Product Name(+)-3-Methylcyclohexanone
- CAS13368-65-5
- MFC7H12O
- MW112.17
- EINECS236-438-6
- MOL File13368-65-5.mol
Chemical Properties
| Boiling point | 168-169 °C(lit.) |
| Density | 0.916 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 125 °F |
| solubility | Insoluble in water, soluble in alcohol and oils. |
| form | liquid |
| Specific Gravity | 0.92 |
| color | Colorless |
| Odor | Fresh, camphoraceous-minty, but rather weak odor of poor tenacity. |
| optical activity | [α]24/D +13.5°, neat |
| Dielectric constant | 12.4 |
| InChI | InChI=1S/C7H12O/c1-6-3-2-4-7(8)5-6/h6H,2-5H2,1H3/t6-/m1/s1 |
| InChIKey | UJBOOUHRTQVGRU-ZCFIWIBFSA-N |
| SMILES | C1(=O)CCC[C@@H](C)C1 |
| LogP | 1.356 (est) |
Safety Information
| Risk Statements | 10 |
| Safety Statements | 16-27-36/37/39 |
| RIDADR | UN 2297 3/PG 3 |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
