2-Cyano-4-methylpyridine
- Product Name2-Cyano-4-methylpyridine
- CAS1620-76-4
- MFC7H6N2
- MW118.14
- EINECS627-197-1
- MOL File1620-76-4.mol
Chemical Properties
| Melting point | 83-87 °C |
| Boiling point | 145-148°C 38mm |
| Density | 1.08±0.1 g/cm3(Predicted) |
| Flash point | 145-148°C/38mm |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 0.35±0.10(Predicted) |
| form | powder to crystal |
| color | White to Gray to Brown |
| Water Solubility | Slightly soluble in water. |
| BRN | 110753 |
| InChI | InChI=1S/C7H6N2/c1-6-2-3-9-7(4-6)5-8/h2-4H,1H3 |
| InChIKey | LQAWSWUFSHYCHP-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=CC(C)=C1 |
| CAS DataBase Reference | 1620-76-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-41-37/38-22-36/37/38 |
| Safety Statements | 22-36/37-39-26-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |