2-Cyano-4-methylpyridine
- Product Name2-Cyano-4-methylpyridine
- CAS1620-76-4
- CBNumberCB8707644
- MFC7H6N2
- MW118.14
- EINECS627-197-1
- MDL NumberMFCD00128868
- MOL File1620-76-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 83-87 °C |
| Boiling point | 145-148°C 38mm |
| Density | 1.08±0.1 g/cm3(Predicted) |
| Flash point | 145-148°C/38mm |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 0.35±0.10(Predicted) |
| form | powder to crystal |
| color | White to Gray to Brown |
| Water Solubility | Slightly soluble in water. |
| BRN | 110753 |
| InChI | InChI=1S/C7H6N2/c1-6-2-3-9-7(4-6)5-8/h2-4H,1H3 |
| InChIKey | LQAWSWUFSHYCHP-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=CC(C)=C1 |
| CAS DataBase Reference | 1620-76-4(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H318-H335 | |||||||||
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 20/21/22-41-37/38-22-36/37/38 | |||||||||
| Safety Statements | 22-36/37-39-26-36 | |||||||||
| RIDADR | 3276 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29333990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|


