4-Chloro-pyridine-2-carbonitrile
- Product Name4-Chloro-pyridine-2-carbonitrile
- CAS19235-89-3
- MFC6H3ClN2
- MW138.55
- EINECS606-272-2
- MOL File19235-89-3.mol
Chemical Properties
| Melting point | 81-85 °C |
| Boiling point | 231.6±20.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -2.74±0.10(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C6H3ClN2/c7-5-1-2-9-6(3-5)4-8/h1-3H |
| InChIKey | DYEZRXLVZMZHQT-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=CC(Cl)=C1 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |