4-Bromomethyl-2-cyanobiphenyl
- Product Name4-Bromomethyl-2-cyanobiphenyl
- CAS114772-54-2
- MFC14H10BrN
- MW272.14
- EINECS601-327-7
- MOL File114772-54-2.mol
Chemical Properties
| Melting point | 125-128 °C (lit.) |
| Boiling point | 413.2±38.0 °C(Predicted) |
| Density | 1.43±0.1 g/cm3(Predicted) |
| vapor pressure | 0.1-0.2Pa at 20-25℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C14H10BrN/c15-9-11-5-7-12(8-6-11)14-4-2-1-3-13(14)10-16/h1-8H,9H2 |
| InChIKey | LFFIEVAMVPCZNA-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CBr)C=C2)=CC=CC=C1C#N |
| LogP | 3.2 |
| CAS DataBase Reference | 114772-54-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn,N |
| Risk Statements | 20/21/22-36/37/38-50/53-43 |
| Safety Statements | 26-36/37-36/37/39-61-60 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
