3,4,5-Trihydroxybenzaldehyde
- Product Name3,4,5-Trihydroxybenzaldehyde
- CAS13677-79-7
- MFC7H6O4
- MW154.12
- EINECS237-168-1
- MOL File13677-79-7.mol
Chemical Properties
| Melting point | 211-213°C |
| Boiling point | 237.46°C (rough estimate) |
| Density | 1.3725 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in DMSO and Methanol. |
| form | Solid |
| pka | 7.46±0.23(Predicted) |
| color | White to Pale Yellow |
| Sensitive | Air Sensitive |
| BRN | 2091654 |
| InChI | InChI=1S/C7H6O4/c8-3-4-1-5(9)7(11)6(10)2-4/h1-3,9-11H |
| InChIKey | RGZHEOWNTDJLAQ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(O)=C(O)C(O)=C1 |
| CAS DataBase Reference | 13677-79-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/39-37 |
| HS Code | 29130000 |
