3',4',5'-Trimethoxyacetophenone
- Product Name3',4',5'-Trimethoxyacetophenone
- CAS1136-86-3
- MFC11H14O4
- MW210.23
- EINECS214-501-9
- MOL File1136-86-3.mol
Chemical Properties
| Melting point | 78-80 °C(lit.) |
| Boiling point | 173-174 °C10 mm Hg(lit.) |
| Density | 1.1922 (rough estimate) |
| refractive index | 1.5075 (estimate) |
| Flash point | 173-174°C/10mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Water Solubility | Slightly soluble in water. |
| BRN | 1463133 |
| InChI | InChI=1S/C11H14O4/c1-7(12)8-5-9(13-2)11(15-4)10(6-8)14-3/h5-6H,1-4H3 |
| InChIKey | VUGQIIQFXCXZJU-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(OC)=C(OC)C(OC)=C1)C |
| CAS DataBase Reference | 1136-86-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 1-(3,4,5-trimethoxyphenyl)-(1136-86-3) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 22-24/25-45-36/37/39-27-26 |
| WGK Germany | 3 |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |