1-Chloro-3-methyl-2-butene
- Product Name1-Chloro-3-methyl-2-butene
- CAS503-60-6
- MFC5H9Cl
- MW104.58
- EINECS207-972-7
- MOL File503-60-6.mol
Chemical Properties
| Boiling point | 58-59 °C/120 mmHg (lit.) |
| Density | 0.928 g/mL at 25 °C (lit.) |
| RTECS | EM4298500 |
| refractive index | n |
| Flash point | 56 °F |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Ethyl Acetate |
| form | clear liquid |
| color | Colorless to Light yellow |
| Water Solubility | Miscible with chloroform, acetone, diethyl ether and alcohol. Immiscible with water. |
| InChI | InChI=1S/C5H9Cl/c1-5(2)3-4-6/h3H,4H2,1-2H3 |
| InChIKey | JKXQKGNGJVZKFA-UHFFFAOYSA-N |
| SMILES | C(Cl)/C=C(/C)\C |
| CAS DataBase Reference | 503-60-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Butene, 1-chloro-3-methyl-(503-60-6) |
| EPA Substance Registry System | 2-Butene, 1-chloro-3-methyl- (503-60-6) |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-27-36/37/39 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29032990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 503-60-6(Hazardous Substances Data) |
