4-Chlorophenoxyacetyl chloride
- Product Name4-Chlorophenoxyacetyl chloride
- CAS4122-68-3
- MFC8H6Cl2O2
- MW205.04
- EINECS223-923-2
- MOL File4122-68-3.mol
Chemical Properties
| Melting point | 18.8 °C (lit.) |
| Boiling point | 142 °C/17 mmHg (lit.) |
| Density | 1.314 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| FreezingPoint | 15.0 to 23.0 ℃ |
| Sensitive | Moisture Sensitive |
| BRN | 609718 |
| InChI | InChI=1S/C8H6Cl2O2/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2 |
| InChIKey | VRBVHQUSAOKVDH-UHFFFAOYSA-N |
| SMILES | C(Cl)(COC1=CC=C(Cl)C=C1)=O |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 23-26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29189900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |