| Melting point |
-19 °C |
| Boiling point |
114-115 °C/1 mmHg (lit.) |
| Density |
1.019 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.555(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
powder to lump to clear liquid |
| pka |
14.67±0.10(Predicted) |
| color |
White or Colorless to Yellow to Orange |
| Water Solubility |
insoluble |
| InChI |
InChI=1S/C11H17NO/c1-3-12(7-8-13)11-6-4-5-10(2)9-11/h4-6,9,13H,3,7-8H2,1-2H3 |
| InChIKey |
KRNUKKZDGDAWBF-UHFFFAOYSA-N |
| SMILES |
C(O)CN(CC)C1=CC=CC(C)=C1 |
| CAS DataBase Reference |
91-88-3(CAS DataBase Reference) |
| NIST Chemistry Reference |
Ethanol, 2-[ethyl(3-methylphenyl)amino]-(91-88-3) |
| EPA Substance Registry System |
2-(N-Ethyl-m-toluidino)ethanol (91-88-3) |
