3,4-(Methylenedioxy)phenylacetic acid
- Product Name3,4-(Methylenedioxy)phenylacetic acid
- CAS2861-28-1
- MFC9H8O4
- MW180.16
- EINECS220-679-9
- MOL File2861-28-1.mol
Chemical Properties
| Melting point | 125-129 °C(lit.) |
| Boiling point | 272.96°C (rough estimate) |
| Density | 1.2933 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Micro-Crystalline Powder |
| pka | 4.31±0.10(Predicted) |
| color | Beite to pale yellow |
| Water Solubility | Soluble in water (partly), ethanol, and methanol. |
| BRN | 177739 |
| InChI | InChI=1S/C9H8O4/c10-9(11)4-6-1-2-7-8(3-6)13-5-12-7/h1-3H,4-5H2,(H,10,11) |
| InChIKey | ODVLMCWNGKLROU-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(CC(O)=O)C=C2OC1 |
| CAS DataBase Reference | 2861-28-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
