| Melting point |
25°C |
| Boiling point |
133-135 °C14 mm Hg(lit.) |
| Density |
1.585 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.503(lit.) |
| Flash point |
>230 °F |
| storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| Specific Gravity |
1.585 |
| Sensitive |
Moisture Sensitive |
| BRN |
2651854 |
| InChI |
InChI=1S/C7H4ClF3O2S/c8-14(12,13)6-4-2-1-3-5(6)7(9,10)11/h1-4H |
| InChIKey |
ZIZGWNOAHUCACM-UHFFFAOYSA-N |
| SMILES |
C1(S(Cl)(=O)=O)=CC=CC=C1C(F)(F)F |
| CAS DataBase Reference |
776-04-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
o-Trifluoromethylbenzenesulfonyl chloride(776-04-5) |
