2-(Trifluoromethyl)benzenesulfonyl chloride
- Product Name2-(Trifluoromethyl)benzenesulfonyl chloride
- CAS776-04-5
- CBNumberCB7238527
- MFC7H4ClF3O2S
- MW244.62
- EINECS1533716-785-6
- MDL NumberMFCD00051696
- MOL File776-04-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 25°C |
| Boiling point | 133-135 °C14 mm Hg(lit.) |
| Density | 1.585 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.585 |
| Sensitive | Moisture Sensitive |
| BRN | 2651854 |
| InChI | InChI=1S/C7H4ClF3O2S/c8-14(12,13)6-4-2-1-3-5(6)7(9,10)11/h1-4H |
| InChIKey | ZIZGWNOAHUCACM-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=CC=C1C(F)(F)F |
| CAS DataBase Reference | 776-04-5(CAS DataBase Reference) |
| NIST Chemistry Reference | o-Trifluoromethylbenzenesulfonyl chloride(776-04-5) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 23-26-27-36/37/39-45 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive/Moisture Sensitive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29049090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B | |||||||||
| NFPA 704: |
|
