4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate
- Product Name4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate
- CAS65802-56-4
- MFC4H7N3O2S
- MW161.18
- EINECS629-168-9
- MOL File65802-56-4.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| color | Off-White to Pale Yellow |
| Water Solubility | Soluble in water and DMSO. |
| BRN | 5795441 |
| InChI | InChI=1S/C4H5N3OS.H2O/c5-2-1-3(8)7-4(9)6-2;/h1H,(H4,5,6,7,8,9);1H2 |
| InChIKey | BWYGMIYEADAIGW-UHFFFAOYSA-N |
| SMILES | NC1NC(=S)NC(=O)C=1.O |
| CAS DataBase Reference | 65802-56-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26-24/25 |
| WGK Germany | 3 |
| RTECS | UW0495000 |
| TSCA | Yes |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
