3-Bromo-2-pyridinamine
- Product Name3-Bromo-2-pyridinamine
- CAS13534-99-1
- MFC5H5BrN2
- MW173.01
- EINECS629-620-5
- MOL File13534-99-1.mol
Chemical Properties
| Melting point | 63-67 °C |
| Boiling point | 232.0±20.0 °C(Predicted) |
| Density | 1.6065 (rough estimate) |
| vapor pressure | 0.83-1.8Pa at 20-25℃ |
| refractive index | 1.5182 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.14±0.36(Predicted) |
| form | Powder |
| color | Gray to brown |
| BRN | 109867 |
| InChI | InChI=1S/C5H5BrN2/c6-4-2-1-3-8-5(4)7/h1-3H,(H2,7,8) |
| InChIKey | RBCARPJOEUEZLS-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC=C1Br |
| LogP | 1.5 at 20℃ and pH7 |
| CAS DataBase Reference | 13534-99-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | II |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |