2-Hydroxy-3-methoxybenzyl alcohol
- Product Name2-Hydroxy-3-methoxybenzyl alcohol
- CAS4383-05-5
- MFC8H10O3
- MW154.16
- EINECS224-488-1
- MOL File4383-05-5.mol
Chemical Properties
| Melting point | 61-63 °C (lit.) |
| Boiling point | 135 °C/0.2 mmHg (lit.) |
| Density | 1.1690 (rough estimate) |
| refractive index | 1.4620 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 9.93±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H10O3/c1-11-7-4-2-3-6(5-9)8(7)10/h2-4,9-10H,5H2,1H3 |
| InChIKey | OSZHSESNQIMXMZ-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=CC(OC)=C1O |
| LogP | 0.543 (est) |
| CAS DataBase Reference | 4383-05-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Hydroxy-3-methoxybenzyl alcohol(4383-05-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HS Code | 2909500090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
