1,3-Dichloroisoquinoline
- Product Name1,3-Dichloroisoquinoline
- CAS7742-73-6
- MFC9H5Cl2N
- MW198.05
- EINECS627-814-4
- MOL File7742-73-6.mol
Chemical Properties
| Melting point | 121-122 °C (lit.) |
| Boiling point | 307°C(lit.) |
| Density | 1.407±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -1.49±0.50(Predicted) |
| color | Light yellow to Brown to Dark green |
| InChI | InChI=1S/C9H5Cl2N/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-5H |
| InChIKey | BRGZEQXWZWBPJH-UHFFFAOYSA-N |
| SMILES | C1(Cl)C2=C(C=CC=C2)C=C(Cl)N=1 |
| CAS DataBase Reference | 7742-73-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |