1-tert-Butyl-4-chlorobenzene
- Product Name1-tert-Butyl-4-chlorobenzene
- CAS3972-56-3
- MFC10H13Cl
- MW168.66
- EINECS223-598-7
- MOL File3972-56-3.mol
Chemical Properties
| Melting point | 36°C (estimate) |
| Boiling point | 216 °C |
| Density | 1.01 |
| refractive index | 1.5123 |
| Flash point | 23 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| InChI | InChI=1S/C10H13Cl/c1-10(2,3)8-4-6-9(11)7-5-8/h4-7H,1-3H3 |
| InChIKey | XRTANKYQJQXSFP-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(C(C)(C)C)C=C1 |
| CAS DataBase Reference | 3972-56-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Chloro-4-(1,1-dimethylethyl)benzene(3972-56-3) |
| EPA Substance Registry System | 4-tert-Butylchlorobenzene (3972-56-3) |
