| Melting point |
283-286°C |
| Density |
1.36 |
| refractive index |
1.6430 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
pKa 7.71 (Uncertain) |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
509mg/L(25 ºC) |
| BRN |
120488 |
| Stability |
Stable but may be heat or light sensitive. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
| InChIKey |
ZLAQATDNGLKIEV-UHFFFAOYSA-N |
| SMILES |
C1(=S)NC=C(C)C(=O)N1 |
| CAS DataBase Reference |
636-26-0(CAS DataBase Reference) |
| NIST Chemistry Reference |
4(1H)-pyrimidinone, 2,3-dihydro-5-methyl-2-thioxo-(636-26-0) |
| EPA Substance Registry System |
5-Methyl-2-thiouracil (636-26-0) |
