3-Ethoxyacryloyl chloride
- Product Name3-Ethoxyacryloyl chloride
- CAS6191-99-7
- MFC5H7ClO2
- MW134.56
- EINECS228-239-8
- MOL File6191-99-7.mol
Chemical Properties
| Boiling point | 75°C/10mmHg(lit.) |
| Density | 1.125±0.06 g/cm3(Predicted) |
| refractive index | 1.4860 to 1.4910 |
| Flash point | 25 °C |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C5H7ClO2/c1-2-8-4-3-5(6)7/h3-4H,2H2,1H3 |
| InChIKey | SFMFACMIOWQIPR-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C=COCC |
Safety Information
| Hazard Codes | C |
| Risk Statements | 10-22-34-42/43 |
| Safety Statements | 23-24-26-36/37/39-45 |
| RIDADR | UN2920 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8/3 |
| PackingGroup | II |
| HS Code | 2909500090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Flam. Liq. 3 Resp. Sens. 1 Skin Corr. 1B Skin Sens. 1 |