Tributyltin azide
- Product NameTributyltin azide
- CAS17846-68-3
- MFC12H27N3Sn
- MW332.07
- EINECS
- MOL File17846-68-3.mol
Chemical Properties
| Boiling point | 120°C/0.2mmHg |
| Density | 1.212 g/mL at 25 °C(lit.) |
| refractive index | 1.5745 |
| Flash point | >230 °F |
| solubility | Miscible with toluene, hexane, acetonitrile and tetrahydrofuran. |
| form | liquid |
| Specific Gravity | 1.212 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/3C4H9.N3.Sn/c3*1-3-4-2;1-3-2;/h3*1,3-4H2,2H3;;/q;;;-1;+1 |
| InChIKey | JKVRTUCVPZTEQZ-UHFFFAOYSA-N |
| SMILES | [Sn](N=[N+]=[N-])(CCCC)(CCCC)CCCC |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 6.1 |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
