Methacrylatoethyl trimethyl ammonium chloride
- Product NameMethacrylatoethyl trimethyl ammonium chloride
- CAS5039-78-1
- MFC9H18ClNO2
- MW207.7
- EINECS225-733-5
- MOL File5039-78-1.mol
Chemical Properties
| Melting point | -25°C |
| Boiling point | >100°C |
| Density | 1.105 g/mL at 25 °C |
| refractive index | n |
| Flash point | >100°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | It is soluble in water. |
| BRN | 8168395 |
| Stability | Stable. Incompatible with steel, rust, reducing agents, heavy metal salts, carbon dioxide, oxidizing agents. May be prone to hazardous spontaneous polymerisation. |
| InChI | 1S/C9H18NO2.ClH/c1-8(2)9(11)12-7-6-10(3,4)5;/h1,6-7H2,2-5H3;1H/q+1;/p-1 |
| InChIKey | RRHXZLALVWBDKH-UHFFFAOYSA-M |
| SMILES | [Cl-].CC(=C)C(=O)OCC[N+](C)(C)C |
| LogP | -2.49 at 20℃ and pH7 |
| CAS DataBase Reference | 5039-78-1(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanaminium, N,N,N-trimethyl-2-[(2-methyl-1-oxo-2-propenyl)oxy]-, chloride (5039-78-1) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/38-43-36 |
| Safety Statements | 26-36-36/37-24/25 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
