2-Bromoterephthalic acid
- Product Name2-Bromoterephthalic acid
- CAS586-35-6
- MFC8H5BrO4
- MW245.03
- EINECS209-572-8
- MOL File586-35-6.mol
Chemical Properties
| Melting point | 295-297 °C(lit.) |
| Boiling point | 421.6±40.0 °C(Predicted) |
| Density | 1.8281 (rough estimate) |
| refractive index | 1.4490 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.44±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | Soluble in water. |
| BRN | 2616163 |
| InChI | InChI=1S/C8H5BrO4/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | QPBGNSFASPVGTP-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=C(C(O)=O)C=C1Br |
| CAS DataBase Reference | 586-35-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,C,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36-45-37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 6.1 |
| HS Code | 29173919 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |