2-hydroxyterephthalic acid
- Product Name2-hydroxyterephthalic acid
- CAS636-94-2
- MFC8H6O5
- MW182.13
- EINECS
- MOL File636-94-2.mol
Chemical Properties
| Melting point | 312-317 °C |
| Boiling point | 436.9±40.0 °C(Predicted) |
| Density | 1.612±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 2.56±0.10(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C8H6O5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,9H,(H,10,11)(H,12,13) |
| InChIKey | CDOWNLMZVKJRSC-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=C(C(O)=O)C=C1O |
| CAS DataBase Reference | 636-94-2 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |