1,4-DIBROMO-2-FLUOROBENZENE
- Product Name1,4-DIBROMO-2-FLUOROBENZENE
- CAS1435-52-5
- MFC6H3Br2F
- MW253.89
- EINECS629-432-3
- MOL File1435-52-5.mol
Chemical Properties
| Melting point | 33-36 °C (lit.) |
| Boiling point | 216 °C (lit.) |
| Density | 2.0491 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| Flash point | 215 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorles to Yellow to Orange |
| Water Solubility | Insoluble in water. |
| FreezingPoint | 32.0 to 34.0 ℃ |
| BRN | 3236451 |
| InChI | InChI=1S/C6H3Br2F/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| InChIKey | WNSNPGHNIJOOPM-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 1435-52-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
