1,3-Dibromo-5-fluorobenzene
- Product Name1,3-Dibromo-5-fluorobenzene
- CAS1435-51-4
- MFC6H3Br2F
- MW253.89
- EINECS215-860-4
- MOL File1435-51-4.mol
Chemical Properties
| Boiling point | 204-206 °C/768 mmHg (lit.) |
| Density | 2.018 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Yellow to Green |
| Specific Gravity | 2.02 |
| BRN | 2353462 |
| InChI | InChI=1S/C6H3Br2F/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | ASWYHZXKFSLNLN-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=CC(Br)=C1 |
| CAS DataBase Reference | 1435-51-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |