1,4-Dibromo-2,5-difluorobenzene
- Product Name1,4-Dibromo-2,5-difluorobenzene
- CAS327-51-5
- MFC6H2Br2F2
- MW271.88
- EINECS206-317-2
- MOL File327-51-5.mol
Chemical Properties
| Melting point | 60-62 °C (lit.) |
| Boiling point | 96 °C/20 mmHg (lit.) |
| Density | 2.1030 (rough estimate) |
| refractive index | 1.5151 (estimate) |
| Flash point | 96°C/20mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | insoluble |
| BRN | 2250095 |
| InChI | InChI=1S/C6H2Br2F2/c7-3-1-5(9)4(8)2-6(3)10/h1-2H |
| InChIKey | GLVMLJCMUBZVTJ-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=C(Br)C=C1F |
| CAS DataBase Reference | 327-51-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Dibromo-2,5-difluorobenzene(327-51-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
